C20H27ClN2O2P+ — CID 54109770
[2-chloro-5-(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)phenyl]-ethylphosphanyl-methyl-propylazanium (PubChem CID 54109770) has the molecular formula C20H27ClN2O2P+ and a molecular weight of 393.88 g/mol. Its IUPAC name is [2-chloro-5-(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)phenyl]-ethylphosphanyl-methyl-propylazanium.
| Compound Name | [2-chloro-5-(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)phenyl]-ethylphosphanyl-methyl-propylazanium |
|---|---|
| PubChem CID | 54109770 |
| Molecular Formula | C20H27ClN2O2P+ |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [2-chloro-5-(1,3-dioxo-3a,4,5,7a-tetrahydroisoindol-2-yl)phenyl]-ethylphosphanyl-methyl-propylazanium |
| SMILES | CCC[N+](C)(PCC)c1cc(N2C(=O)C3C=CCCC3C2=O)ccc1Cl |
| InChI | InChI=1S/C20H27ClN2O2P/c1-4-12-23(3,26-5-2)18-13-14(10-11-17(18)21)22-19(24)15-8-6-7-9-16(15)20(22)25/h6,8,10-11,13,15-16,26H,4-5,7,9,12H2,1-3H3/q+1 |
| InChIKey | JWJFIYLSAFJSDG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|