About 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine
3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine (PubChem CID 54109780) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine.
Molecular Properties
| Compound Name | 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine |
| PubChem CID | 54109780 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine |
| SMILES | Nc1c2c(nc3ccccc13)COCC2 |
| InChI | InChI=1S/C12H12N2O/c13-12-8-3-1-2-4-10(8)14-11-7-15-6-5-9(11)12/h1-4H,5-7H2,(H2,13,14) |
| InChIKey | NGGWBBQGQXTORY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine?
The IUPAC name of 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine (CID 54109780) is 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine.
What is the SMILES notation for 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine?
The canonical SMILES for 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine is Nc1c2c(nc3ccccc13)COCC2.
What is the InChIKey of 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine?
The InChIKey is NGGWBBQGQXTORY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c13-12-8-3-1-2-4-10(8)14-11-7-15-6-5-9(11)12/h1-4H,5-7H2,(H2,13,14).
What are the key properties of 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine?
3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine has a molecular weight of 200.24 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-1H-pyrano[3,4-b]quinolin-5-amine is sourced from PubChem (CID 54109780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).