C8H10F7ISi — CID 54109893
(3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-en-2-yl)-trimethylsilane (PubChem CID 54109893) has the molecular formula C8H10F7ISi and a molecular weight of 394.14 g/mol. Its IUPAC name is (3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-en-2-yl)-trimethylsilane.
| Compound Name | (3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-en-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 54109893 |
| Molecular Formula | C8H10F7ISi |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | (3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-en-2-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C(=CI)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7ISi/c1-17(2,3)5(4-16)6(9,10)7(11,12)8(13,14)15/h4H,1-3H3 |
| InChIKey | NGIWAJKSZKYNMC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|