methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate

C7H10F2N2O4 — CID 54110744

IUPACmethyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate
SMILES[H]/N=C(\OC)C(=NOCC(F)F)C(=O)OC
InChIInChI=1S/C7H10F2N2O4/c1-13-6(10)5(7(12)14-2)11-15-3-4(8)9/h4,10H,3H2,1-2H3/b10-6-,11-5?
InChIKeyNGXOAXBIWBAJTC-AHZGSYSPSA-N
MW224.16 g/mol
LogP0.42
Rot. Bonds5

About methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate

methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate (PubChem CID 54110744) has the molecular formula C7H10F2N2O4 and a molecular weight of 224.16 g/mol. Its IUPAC name is methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate.

Molecular Properties

Compound Namemethyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate
PubChem CID54110744
Molecular FormulaC7H10F2N2O4
Molecular Weight224.16 g/mol
Exact Mass224.06
IUPAC Namemethyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate
SMILES[H]/N=C(\OC)C(=NOCC(F)F)C(=O)OC
InChIInChI=1S/C7H10F2N2O4/c1-13-6(10)5(7(12)14-2)11-15-3-4(8)9/h4,10H,3H2,1-2H3/b10-6-,11-5?
InChIKeyNGXOAXBIWBAJTC-AHZGSYSPSA-N
XLogP0.42
TPSA80.97 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.16
LogP ≤ 50.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate?
The IUPAC name of methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate (CID 54110744) is methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate.
What is the SMILES notation for methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate?
The canonical SMILES for methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate is [H]/N=C(\OC)C(=NOCC(F)F)C(=O)OC.
What is the InChIKey of methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate?
The InChIKey is NGXOAXBIWBAJTC-AHZGSYSPSA-N. The full InChI is InChI=1S/C7H10F2N2O4/c1-13-6(10)5(7(12)14-2)11-15-3-4(8)9/h4,10H,3H2,1-2H3/b10-6-,11-5?.
What are the key properties of methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate?
methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate has a molecular weight of 224.16 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,2-difluoroethoxyimino)-3-imino-3-methoxypropanoate is sourced from PubChem (CID 54110744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).