C21H24F3NO5S — CID 54110943
[6-[2-[(3S)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-4-yl]ethenyl]-3-pyridinyl] trifluoromethanesulfonate (PubChem CID 54110943) has the molecular formula C21H24F3NO5S and a molecular weight of 459.49 g/mol. Its IUPAC name is [6-[2-[(3S)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-4-yl]ethenyl]-3-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [6-[2-[(3S)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-4-yl]ethenyl]-3-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54110943 |
| Molecular Formula | C21H24F3NO5S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [6-[2-[(3S)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-4-yl]ethenyl]-3-pyridinyl] trifluoromethanesulfonate |
| SMILES | CC1OC(=O)C2CC3CCCCC3C(C=Cc3ccc(OS(=O)(=O)C(F)(F)F)cn3)C12 |
| InChI | InChI=1S/C21H24F3NO5S/c1-12-19-17(16-5-3-2-4-13(16)10-18(19)20(26)29-12)9-7-14-6-8-15(11-25-14)30-31(27,28)21(22,23)24/h6-9,11-13,16-19H,2-5,10H2,1H3 |
| InChIKey | NHAVVPKNUKEJAY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|