C21H16F3N5O4S — CID 54111177
[1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate (PubChem CID 54111177) has the molecular formula C21H16F3N5O4S and a molecular weight of 491.45 g/mol. Its IUPAC name is [1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate.
| Compound Name | [1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate |
|---|---|
| PubChem CID | 54111177 |
| Molecular Formula | C21H16F3N5O4S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [1,3-dimethyl-4-[4-(1,2,4-triazol-1-yl)-2-(trifluoromethyl)benzoyl]pyrazol-5-yl] benzenesulfonate |
| SMILES | Cc1nn(C)c(OS(=O)(=O)c2ccccc2)c1C(=O)c1ccc(-n2cncn2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H16F3N5O4S/c1-13-18(20(28(2)27-13)33-34(31,32)15-6-4-3-5-7-15)19(30)16-9-8-14(29-12-25-11-26-29)10-17(16)21(22,23)24/h3-12H,1-2H3 |
| InChIKey | NHERDROEQZLFAI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|