About 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole
3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole (PubChem CID 54111264) has the molecular formula C18H23N2O4P
and a molecular weight of 362.37 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole |
| PubChem CID | 54111264 |
| Molecular Formula | C18H23N2O4P |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole |
| SMILES | CCOCc1cccc2[nH]c3cnc(P(=O)(OCC)OCC)cc3c12 |
| InChI | InChI=1S/C18H23N2O4P/c1-4-22-12-13-8-7-9-15-18(13)14-10-17(19-11-16(14)20-15)25(21,23-5-2)24-6-3/h7-11,20H,4-6,12H2,1-3H3 |
| InChIKey | NHGIDDHFQSTGMI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole (CID 54111264) is 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole is CCOCc1cccc2[nH]c3cnc(P(=O)(OCC)OCC)cc3c12.
What is the InChIKey of 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole?
The InChIKey is NHGIDDHFQSTGMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N2O4P/c1-4-22-12-13-8-7-9-15-18(13)14-10-17(19-11-16(14)20-15)25(21,23-5-2)24-6-3/h7-11,20H,4-6,12H2,1-3H3.
What are the key properties of 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole?
3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole has a molecular weight of 362.37 g/mol, XLogP of 4.14, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethoxyphosphoryl-5-(ethoxymethyl)-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 54111264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).