C34H51F3N4O9S2 — CID 54111796
[4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]anilino] 2,4-dimethyl-3-[[2-[2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]acetyl]amino]benzenesulfonate (PubChem CID 54111796) has the molecular formula C34H51F3N4O9S2 and a molecular weight of 780.93 g/mol. Its IUPAC name is [4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]anilino] 2,4-dimethyl-3-[[2-[2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]acetyl]amino]benzenesulfonate.
| Compound Name | [4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]anilino] 2,4-dimethyl-3-[[2-[2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]acetyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 54111796 |
| Molecular Formula | C34H51F3N4O9S2 |
| Molecular Weight | 780.93 g/mol |
| Exact Mass | 780.30 |
| IUPAC Name | [4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]anilino] 2,4-dimethyl-3-[[2-[2-[2-[2-(2-octoxyethoxy)ethoxy]ethoxy]ethylsulfanyl]acetyl]amino]benzenesulfonate |
| SMILES | CCCCCCCCOCCOCCOCCOCCSCC(=O)Nc1c(C)ccc(S(=O)(=O)ONc2ccc(NNC(=O)C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C34H51F3N4O9S2/c1-4-5-6-7-8-9-16-46-17-18-47-19-20-48-21-22-49-23-24-51-25-31(42)38-32-26(2)10-15-30(27(32)3)52(44,45)50-41-29-13-11-28(12-14-29)39-40-33(43)34(35,36)37/h10-15,39,41H,4-9,16-25H2,1-3H3,(H,38,42)(H,40,43) |
| InChIKey | HJXKJJIMDMAWIY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 162.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.93 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|