C22H8F10O10 — CID 54112190
4-[4-[3,4-bis(dihydroxymethyl)-2,5,6-trifluorophenoxy]-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorophthalic acid (PubChem CID 54112190) has the molecular formula C22H8F10O10 and a molecular weight of 622.28 g/mol. Its IUPAC name is 4-[4-[3,4-bis(dihydroxymethyl)-2,5,6-trifluorophenoxy]-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorophthalic acid.
| Compound Name | 4-[4-[3,4-bis(dihydroxymethyl)-2,5,6-trifluorophenoxy]-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorophthalic acid |
|---|---|
| PubChem CID | 54112190 |
| Molecular Formula | C22H8F10O10 |
| Molecular Weight | 622.28 g/mol |
| Exact Mass | 622.00 |
| IUPAC Name | 4-[4-[3,4-bis(dihydroxymethyl)-2,5,6-trifluorophenoxy]-2,3,5,6-tetrafluorophenoxy]-3,5,6-trifluorophthalic acid |
| SMILES | O=C(O)c1c(F)c(F)c(Oc2c(F)c(F)c(Oc3c(F)c(F)c(C(O)O)c(C(O)O)c3F)c(F)c2F)c(F)c1C(=O)O |
| InChI | InChI=1S/C22H8F10O10/c23-5-1(19(33)34)3(21(37)38)7(25)15(9(5)27)41-17-11(29)13(31)18(14(32)12(17)30)42-16-8(26)4(22(39)40)2(20(35)36)6(24)10(16)28/h19,21,33-34,37-38H,(H,35,36)(H,39,40) |
| InChIKey | NHWYKWGWRTVWQB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|