About 1-N-ethylocta-6,7-diene-1,4-diamine
1-N-ethylocta-6,7-diene-1,4-diamine (PubChem CID 54112890) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-N-ethylocta-6,7-diene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-ethylocta-6,7-diene-1,4-diamine |
| PubChem CID | 54112890 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-N-ethylocta-6,7-diene-1,4-diamine |
| SMILES | C=C=CCC(N)CCCNCC |
| InChI | InChI=1S/C10H20N2/c1-3-5-7-10(11)8-6-9-12-4-2/h5,10,12H,1,4,6-9,11H2,2H3 |
| InChIKey | NIHYLYCFVADCDP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-ethylocta-6,7-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-ethylocta-6,7-diene-1,4-diamine?
The IUPAC name of 1-N-ethylocta-6,7-diene-1,4-diamine (CID 54112890) is 1-N-ethylocta-6,7-diene-1,4-diamine.
What is the SMILES notation for 1-N-ethylocta-6,7-diene-1,4-diamine?
The canonical SMILES for 1-N-ethylocta-6,7-diene-1,4-diamine is C=C=CCC(N)CCCNCC.
What is the InChIKey of 1-N-ethylocta-6,7-diene-1,4-diamine?
The InChIKey is NIHYLYCFVADCDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-3-5-7-10(11)8-6-9-12-4-2/h5,10,12H,1,4,6-9,11H2,2H3.
What are the key properties of 1-N-ethylocta-6,7-diene-1,4-diamine?
1-N-ethylocta-6,7-diene-1,4-diamine has a molecular weight of 168.28 g/mol, XLogP of 1.43, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-ethylocta-6,7-diene-1,4-diamine is sourced from PubChem (CID 54112890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).