C34H36O6 — CID 54113021
(3R,4S,5S,6R)-3,4-dibenzyl-4,5,6,7-tetrahydroxy-1-phenyl-3-phenylmethoxyheptan-2-one (PubChem CID 54113021) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,4-dibenzyl-4,5,6,7-tetrahydroxy-1-phenyl-3-phenylmethoxyheptan-2-one.
| Compound Name | (3R,4S,5S,6R)-3,4-dibenzyl-4,5,6,7-tetrahydroxy-1-phenyl-3-phenylmethoxyheptan-2-one |
|---|---|
| PubChem CID | 54113021 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (3R,4S,5S,6R)-3,4-dibenzyl-4,5,6,7-tetrahydroxy-1-phenyl-3-phenylmethoxyheptan-2-one |
| SMILES | O=C(Cc1ccccc1)[C@](Cc1ccccc1)(OCc1ccccc1)[C@](O)(Cc1ccccc1)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C34H36O6/c35-24-30(36)32(38)33(39,22-27-15-7-2-8-16-27)34(23-28-17-9-3-10-18-28,40-25-29-19-11-4-12-20-29)31(37)21-26-13-5-1-6-14-26/h1-20,30,32,35-36,38-39H,21-25H2/t30-,32+,33+,34+/m1/s1 |
| InChIKey | NIKBLOURVIBMQW-ZQTBNDFDSA-N |
| XLogP | 3.68 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |