C21H29F5OS — CID 54113312
[4-[1,1,2,2-tetrafluoro-2-(4-heptoxycyclohexyl)ethyl]phenyl] thiohypofluorite (PubChem CID 54113312) has the molecular formula C21H29F5OS and a molecular weight of 424.52 g/mol. Its IUPAC name is [4-[1,1,2,2-tetrafluoro-2-(4-heptoxycyclohexyl)ethyl]phenyl] thiohypofluorite.
| Compound Name | [4-[1,1,2,2-tetrafluoro-2-(4-heptoxycyclohexyl)ethyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 54113312 |
| Molecular Formula | C21H29F5OS |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | [4-[1,1,2,2-tetrafluoro-2-(4-heptoxycyclohexyl)ethyl]phenyl] thiohypofluorite |
| SMILES | CCCCCCCOC1CCC(C(F)(F)C(F)(F)c2ccc(SF)cc2)CC1 |
| InChI | InChI=1S/C21H29F5OS/c1-2-3-4-5-6-15-27-18-11-7-16(8-12-18)20(22,23)21(24,25)17-9-13-19(28-26)14-10-17/h9-10,13-14,16,18H,2-8,11-12,15H2,1H3 |
| InChIKey | NIPNAENSSDWJPN-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|