C21H27Cl3N3OPS — CID 54113454
N,N-dipropyl-N'-[propyl-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]benzenecarboximidamide (PubChem CID 54113454) has the molecular formula C21H27Cl3N3OPS and a molecular weight of 506.87 g/mol. Its IUPAC name is N,N-dipropyl-N'-[propyl-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]benzenecarboximidamide.
| Compound Name | N,N-dipropyl-N'-[propyl-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 54113454 |
| Molecular Formula | C21H27Cl3N3OPS |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | N,N-dipropyl-N'-[propyl-[(3,5,6-trichloro-2-pyridinyl)oxy]phosphinothioyl]benzenecarboximidamide |
| SMILES | CCCN(CCC)C(=NP(=S)(CCC)Oc1nc(Cl)c(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H27Cl3N3OPS/c1-4-12-27(13-5-2)20(16-10-8-7-9-11-16)26-29(30,14-6-3)28-21-18(23)15-17(22)19(24)25-21/h7-11,15H,4-6,12-14H2,1-3H3 |
| InChIKey | NIRVOKHLDCMMFW-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|