C4H6Cl3NO2 — CID 54113467
(3R)-4,4,4-trichloro-3-hydroxybutanamide (PubChem CID 54113467) has the molecular formula C4H6Cl3NO2 and a molecular weight of 206.46 g/mol. Its IUPAC name is (3R)-4,4,4-trichloro-3-hydroxybutanamide.
| Compound Name | (3R)-4,4,4-trichloro-3-hydroxybutanamide |
|---|---|
| PubChem CID | 54113467 |
| Molecular Formula | C4H6Cl3NO2 |
| Molecular Weight | 206.46 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | (3R)-4,4,4-trichloro-3-hydroxybutanamide |
| SMILES | NC(=O)C[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H6Cl3NO2/c5-4(6,7)2(9)1-3(8)10/h2,9H,1H2,(H2,8,10)/t2-/m1/s1 |
| InChIKey | NIRYVOBXLRWIOX-UWTATZPHSA-N |
| XLogP | 0.59 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|