About 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid
2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid (PubChem CID 54113679) has the molecular formula C13H15NO5
and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid |
| PubChem CID | 54113679 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid |
| SMILES | CC(C)(C)C(=O)ON=C(C(=O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C13H15NO5/c1-13(2,3)12(18)19-14-10(11(16)17)8-5-4-6-9(15)7-8/h4-7,15H,1-3H3,(H,16,17) |
| InChIKey | NIVQTMCOFWYSQN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid?
The IUPAC name of 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid (CID 54113679) is 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid.
What is the SMILES notation for 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid?
The canonical SMILES for 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid is CC(C)(C)C(=O)ON=C(C(=O)O)c1cccc(O)c1.
What is the InChIKey of 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid?
The InChIKey is NIVQTMCOFWYSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c1-13(2,3)12(18)19-14-10(11(16)17)8-5-4-6-9(15)7-8/h4-7,15H,1-3H3,(H,16,17).
What are the key properties of 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid?
2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid has a molecular weight of 265.26 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoyloxyimino)-2-(3-hydroxyphenyl)acetic acid is sourced from PubChem (CID 54113679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).