About 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol
2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol (PubChem CID 5411396) has the molecular formula C10H9N3O2S
and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol.
Molecular Properties
| Compound Name | 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol |
| PubChem CID | 5411396 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol |
| SMILES | COc1c(O)cccc1/C=N\c1nncs1 |
| InChI | InChI=1S/C10H9N3O2S/c1-15-9-7(3-2-4-8(9)14)5-11-10-13-12-6-16-10/h2-6,14H,1H3/b11-5- |
| InChIKey | DMLOQJWUFWRSKK-WZUFQYTHSA-N |
| XLogP | 2.00 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol?
The IUPAC name of 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol (CID 5411396) is 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol.
What is the SMILES notation for 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol?
The canonical SMILES for 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol is COc1c(O)cccc1/C=N\c1nncs1.
What is the InChIKey of 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol?
The InChIKey is DMLOQJWUFWRSKK-WZUFQYTHSA-N. The full InChI is InChI=1S/C10H9N3O2S/c1-15-9-7(3-2-4-8(9)14)5-11-10-13-12-6-16-10/h2-6,14H,1H3/b11-5-.
What are the key properties of 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol?
2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol has a molecular weight of 235.27 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-[(Z)-1,3,4-thiadiazol-2-yliminomethyl]phenol is sourced from PubChem (CID 5411396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).