C52H83N3O12 — CID 54114553
tert-butyl 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-(4-ethoxyphenyl)propyl]amino]acetate (PubChem CID 54114553) has the molecular formula C52H83N3O12 and a molecular weight of 942.24 g/mol. Its IUPAC name is tert-butyl 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-(4-ethoxyphenyl)propyl]amino]acetate.
| Compound Name | tert-butyl 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-(4-ethoxyphenyl)propyl]amino]acetate |
|---|---|
| PubChem CID | 54114553 |
| Molecular Formula | C52H83N3O12 |
| Molecular Weight | 942.24 g/mol |
| Exact Mass | 941.60 |
| IUPAC Name | tert-butyl 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-(4-ethoxyphenyl)propyl]amino]acetate |
| SMILES | CCOc1ccc(CC(CN(CC(=O)OC(C)(C)C)CC(Cc2ccc(OCC)cc2)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C52H83N3O12/c1-18-61-41-24-20-37(21-25-41)28-39(54(33-44(57)64-49(6,7)8)34-45(58)65-50(9,10)11)30-53(32-43(56)63-48(3,4)5)31-40(29-38-22-26-42(27-23-38)62-19-2)55(35-46(59)66-51(12,13)14)36-47(60)67-52(15,16)17/h20-27,39-40H,18-19,28-36H2,1-17H3 |
| InChIKey | NJKXXTQBFNPWGZ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 159.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.24 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|