About 3-methylpyrrole-2-thione
3-methylpyrrole-2-thione (PubChem CID 54115246) has the molecular formula C5H5NS
and a molecular weight of 111.17 g/mol. Its IUPAC name is 3-methylpyrrole-2-thione.
Molecular Properties
| Compound Name | 3-methylpyrrole-2-thione |
| PubChem CID | 54115246 |
| Molecular Formula | C5H5NS |
| Molecular Weight | 111.17 g/mol |
| Exact Mass | 111.01 |
| IUPAC Name | 3-methylpyrrole-2-thione |
| SMILES | CC1=CC=NC1=S |
| InChI | InChI=1S/C5H5NS/c1-4-2-3-6-5(4)7/h2-3H,1H3 |
| InChIKey | NJWWBHIFEAEXRZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpyrrole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyrrole-2-thione?
The IUPAC name of 3-methylpyrrole-2-thione (CID 54115246) is 3-methylpyrrole-2-thione.
What is the SMILES notation for 3-methylpyrrole-2-thione?
The canonical SMILES for 3-methylpyrrole-2-thione is CC1=CC=NC1=S.
What is the InChIKey of 3-methylpyrrole-2-thione?
The InChIKey is NJWWBHIFEAEXRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NS/c1-4-2-3-6-5(4)7/h2-3H,1H3.
What are the key properties of 3-methylpyrrole-2-thione?
3-methylpyrrole-2-thione has a molecular weight of 111.17 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyrrole-2-thione is sourced from PubChem (CID 54115246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).