C30H30Br2N2O4 — CID 54115456
1-(bromomethyl)-4-methylbenzene;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(3-methylphenyl)methyl]pyridine-3-carboxylate (PubChem CID 54115456) has the molecular formula C30H30Br2N2O4 and a molecular weight of 642.39 g/mol. Its IUPAC name is 1-(bromomethyl)-4-methylbenzene;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(3-methylphenyl)methyl]pyridine-3-carboxylate.
| Compound Name | 1-(bromomethyl)-4-methylbenzene;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(3-methylphenyl)methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54115456 |
| Molecular Formula | C30H30Br2N2O4 |
| Molecular Weight | 642.39 g/mol |
| Exact Mass | 640.06 |
| IUPAC Name | 1-(bromomethyl)-4-methylbenzene;methyl 2-bromopyridine-3-carboxylate;methyl 2-[(3-methylphenyl)methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1Br.COC(=O)c1cccnc1Cc1cccc(C)c1.Cc1ccc(CBr)cc1 |
| InChI | InChI=1S/C15H15NO2.C8H9Br.C7H6BrNO2/c1-11-5-3-6-12(9-11)10-14-13(15(17)18-2)7-4-8-16-14;1-7-2-4-8(6-9)5-3-7;1-11-7(10)5-3-2-4-9-6(5)8/h3-9H,10H2,1-2H3;2-5H,6H2,1H3;2-4H,1H3 |
| InChIKey | NKAIEAIFGYVCBJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.39 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|