C13H23NO3Si — CID 54115482
(2R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-2,6,7,8-tetrahydro-1H-pyrrolizine-3,5-dione (PubChem CID 54115482) has the molecular formula C13H23NO3Si and a molecular weight of 269.42 g/mol. Its IUPAC name is (2R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-2,6,7,8-tetrahydro-1H-pyrrolizine-3,5-dione.
| Compound Name | (2R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-2,6,7,8-tetrahydro-1H-pyrrolizine-3,5-dione |
|---|---|
| PubChem CID | 54115482 |
| Molecular Formula | C13H23NO3Si |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2R,8S)-2-[tert-butyl(dimethyl)silyl]oxy-2,6,7,8-tetrahydro-1H-pyrrolizine-3,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2CCC(=O)N2C1=O |
| InChI | InChI=1S/C13H23NO3Si/c1-13(2,3)18(4,5)17-10-8-9-6-7-11(15)14(9)12(10)16/h9-10H,6-8H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | NKASNSRVDVDUGB-VHSXEESVSA-N |
| XLogP | 2.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|