C44H68N2O2 — CID 54115620
3-[bis(3-methylbutyl)amino]-1-[5-[3-[bis(3-methylbutyl)amino]-2,2-dimethylpropanoyl]anthracen-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 54115620) has the molecular formula C44H68N2O2 and a molecular weight of 657.04 g/mol. Its IUPAC name is 3-[bis(3-methylbutyl)amino]-1-[5-[3-[bis(3-methylbutyl)amino]-2,2-dimethylpropanoyl]anthracen-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-[bis(3-methylbutyl)amino]-1-[5-[3-[bis(3-methylbutyl)amino]-2,2-dimethylpropanoyl]anthracen-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 54115620 |
| Molecular Formula | C44H68N2O2 |
| Molecular Weight | 657.04 g/mol |
| Exact Mass | 656.53 |
| IUPAC Name | 3-[bis(3-methylbutyl)amino]-1-[5-[3-[bis(3-methylbutyl)amino]-2,2-dimethylpropanoyl]anthracen-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)CCN(CCC(C)C)CC(C)(C)C(=O)c1cccc2cc3c(C(=O)C(C)(C)CN(CCC(C)C)CCC(C)C)cccc3cc12 |
| InChI | InChI=1S/C44H68N2O2/c1-31(2)19-23-45(24-20-32(3)4)29-43(9,10)41(47)37-17-13-15-35-28-40-36(27-39(35)37)16-14-18-38(40)42(48)44(11,12)30-46(25-21-33(5)6)26-22-34(7)8/h13-18,27-28,31-34H,19-26,29-30H2,1-12H3 |
| InChIKey | NKDGSOPFYRDAJO-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.04 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|