C27H31F3N8S2 — CID 54115868
4-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 54115868) has the molecular formula C27H31F3N8S2 and a molecular weight of 588.73 g/mol. Its IUPAC name is 4-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | 4-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 54115868 |
| Molecular Formula | C27H31F3N8S2 |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 4-(2,6-dipyrrolidin-1-ylpyrimidin-4-yl)-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1cccc(-c2csc(NC(=S)N3CCN(c4cc(N5CCCC5)nc(N5CCCC5)n4)CC3)n2)c1 |
| InChI | InChI=1S/C27H31F3N8S2/c28-27(29,30)20-7-5-6-19(16-20)21-18-40-25(31-21)34-26(39)38-14-12-36(13-15-38)23-17-22(35-8-1-2-9-35)32-24(33-23)37-10-3-4-11-37/h5-7,16-18H,1-4,8-15H2,(H,31,34,39) |
| InChIKey | NKHRHOPMZCAMJK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|