C14H20O5 — CID 54116309
dimethyl 2-[4-(3,6-dihydro-2H-pyran-2-yl)but-3-enyl]propanedioate (PubChem CID 54116309) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is dimethyl 2-[4-(3,6-dihydro-2H-pyran-2-yl)but-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[4-(3,6-dihydro-2H-pyran-2-yl)but-3-enyl]propanedioate |
|---|---|
| PubChem CID | 54116309 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | dimethyl 2-[4-(3,6-dihydro-2H-pyran-2-yl)but-3-enyl]propanedioate |
| SMILES | COC(=O)C(CCC=CC1CC=CCO1)C(=O)OC |
| InChI | InChI=1S/C14H20O5/c1-17-13(15)12(14(16)18-2)9-4-3-7-11-8-5-6-10-19-11/h3,5-7,11-12H,4,8-10H2,1-2H3 |
| InChIKey | NKOWJWWMBOQDEZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|