C20H39NO2 — CID 54116663
N-ethyl-2-hydroxyoctadec-9-enamide (PubChem CID 54116663) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is N-ethyl-2-hydroxyoctadec-9-enamide.
| Compound Name | N-ethyl-2-hydroxyoctadec-9-enamide |
|---|---|
| PubChem CID | 54116663 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | N-ethyl-2-hydroxyoctadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCC(O)C(=O)NCC |
| InChI | InChI=1S/C20H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(22)20(23)21-4-2/h11-12,19,22H,3-10,13-18H2,1-2H3,(H,21,23) |
| InChIKey | NKUKYKQZFHONOZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|