About N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide
N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide (PubChem CID 5411715) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide |
| PubChem CID | 5411715 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(/C(C)=N\NS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H18N2O4S/c1-12(13-9-10-15(21-2)16(11-13)22-3)17-18-23(19,20)14-7-5-4-6-8-14/h4-11,18H,1-3H3/b17-12- |
| InChIKey | ZEHUTGJKFLTPQQ-ATVHPVEESA-N |
| XLogP | 2.41 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide?
The IUPAC name of N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide (CID 5411715) is N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide.
What is the SMILES notation for N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide?
The canonical SMILES for N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide is COc1ccc(/C(C)=N\NS(=O)(=O)c2ccccc2)cc1OC.
What is the InChIKey of N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide?
The InChIKey is ZEHUTGJKFLTPQQ-ATVHPVEESA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-12(13-9-10-15(21-2)16(11-13)22-3)17-18-23(19,20)14-7-5-4-6-8-14/h4-11,18H,1-3H3/b17-12-.
What are the key properties of N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide?
N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide has a molecular weight of 334.40 g/mol, XLogP of 2.41, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]benzenesulfonamide is sourced from PubChem (CID 5411715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).