C8H8O4 — CID 54117195
5,6-dimethylidenecyclohexa-1,3-diene-1,2,3,4-tetrol (PubChem CID 54117195) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 5,6-dimethylidenecyclohexa-1,3-diene-1,2,3,4-tetrol.
| Compound Name | 5,6-dimethylidenecyclohexa-1,3-diene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 54117195 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 5,6-dimethylidenecyclohexa-1,3-diene-1,2,3,4-tetrol |
| SMILES | C=c1c(O)c(O)c(O)c(O)c1=C |
| InChI | InChI=1S/C8H8O4/c1-3-4(2)6(10)8(12)7(11)5(3)9/h9-12H,1-2H2 |
| InChIKey | NLDOKFRFHHNRGZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|