C13H8FN3O6S2 — CID 54117453
4-(4-fluoro-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid (PubChem CID 54117453) has the molecular formula C13H8FN3O6S2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-(4-fluoro-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid.
| Compound Name | 4-(4-fluoro-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 54117453 |
| Molecular Formula | C13H8FN3O6S2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 4-(4-fluoro-1,3,5-triazin-2-yl)naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(-c3ncnc(F)n3)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C13H8FN3O6S2/c14-13-16-6-15-12(17-13)11-5-9(25(21,22)23)4-7-3-8(24(18,19)20)1-2-10(7)11/h1-6H,(H,18,19,20)(H,21,22,23) |
| InChIKey | LHQQDGSJHGNLAU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|