C20H23Cl6NO4 — CID 54117466
2-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)ethanimine (PubChem CID 54117466) has the molecular formula C20H23Cl6NO4 and a molecular weight of 554.13 g/mol. Its IUPAC name is 2-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)ethanimine.
| Compound Name | 2-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)ethanimine |
|---|---|
| PubChem CID | 54117466 |
| Molecular Formula | C20H23Cl6NO4 |
| Molecular Weight | 554.13 g/mol |
| Exact Mass | 550.98 |
| IUPAC Name | 2-[6-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]hexoxy]-N-(3,3-dichloroprop-2-enoxy)ethanimine |
| SMILES | ClC(Cl)=CCON=CCOCCCCCCOc1c(Cl)cc(OCC=C(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl6NO4/c21-16-13-15(29-10-5-18(23)24)14-17(22)20(16)30-9-4-2-1-3-8-28-12-7-27-31-11-6-19(25)26/h5-7,13-14H,1-4,8-12H2 |
| InChIKey | NLILFUXKNDVOCG-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.13 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|