C15H16F3N3O4S — CID 541175
methyl 2-acetamido-2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoropropanoate (PubChem CID 541175) has the molecular formula C15H16F3N3O4S and a molecular weight of 391.37 g/mol. Its IUPAC name is methyl 2-acetamido-2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-acetamido-2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 541175 |
| Molecular Formula | C15H16F3N3O4S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | methyl 2-acetamido-2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoropropanoate |
| SMILES | CCOc1ccc2nc(NC(NC(C)=O)(C(=O)OC)C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C15H16F3N3O4S/c1-4-25-9-5-6-10-11(7-9)26-13(19-10)21-14(12(23)24-3,15(16,17)18)20-8(2)22/h5-7H,4H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | KXWCCYHBXGCBIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|