About sulfamoylsulfonylurea
sulfamoylsulfonylurea (PubChem CID 54118048) has the molecular formula CH5N3O5S2
and a molecular weight of 203.20 g/mol. Its IUPAC name is sulfamoylsulfonylurea.
Molecular Properties
| Compound Name | sulfamoylsulfonylurea |
| PubChem CID | 54118048 |
| Molecular Formula | CH5N3O5S2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 202.97 |
| IUPAC Name | sulfamoylsulfonylurea |
| SMILES | NC(=O)NS(=O)(=O)S(N)(=O)=O |
| InChI | InChI=1S/CH5N3O5S2/c2-1(5)4-11(8,9)10(3,6)7/h(H3,2,4,5)(H2,3,6,7) |
| InChIKey | NLSNSCNICKQIGJ-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze sulfamoylsulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfamoylsulfonylurea?
The IUPAC name of sulfamoylsulfonylurea (CID 54118048) is sulfamoylsulfonylurea.
What is the SMILES notation for sulfamoylsulfonylurea?
The canonical SMILES for sulfamoylsulfonylurea is NC(=O)NS(=O)(=O)S(N)(=O)=O.
What is the InChIKey of sulfamoylsulfonylurea?
The InChIKey is NLSNSCNICKQIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N3O5S2/c2-1(5)4-11(8,9)10(3,6)7/h(H3,2,4,5)(H2,3,6,7).
What are the key properties of sulfamoylsulfonylurea?
sulfamoylsulfonylurea has a molecular weight of 203.20 g/mol, XLogP of -2.81, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sulfamoylsulfonylurea is sourced from PubChem (CID 54118048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).