C33H35F6N3O2 — CID 54118167
N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide (PubChem CID 54118167) has the molecular formula C33H35F6N3O2 and a molecular weight of 619.65 g/mol. Its IUPAC name is N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 54118167 |
| Molecular Formula | C33H35F6N3O2 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | N-[1-[4-[9-[hydroxy-(2,2,2-trifluoroethylamino)methyl]fluoren-9-yl]butyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(CCCCC2(C(O)NCC(F)(F)F)c3ccccc3-c3ccccc32)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C33H35F6N3O2/c34-32(35,36)21-40-30(44)31(26-12-4-1-9-23(26)24-10-2-5-13-27(24)31)17-7-8-18-42-19-15-22(16-20-42)41-29(43)25-11-3-6-14-28(25)33(37,38)39/h1-6,9-14,22,30,40,44H,7-8,15-21H2,(H,41,43) |
| InChIKey | NLUHQWWCRSLSNR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|