About prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate (PubChem CID 54118590) has the molecular formula C15H28INO3Si
and a molecular weight of 425.38 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 54118590 |
| Molecular Formula | C15H28INO3Si |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CI |
| InChI | InChI=1S/C15H28INO3Si/c1-7-8-19-14(18)17-11-13(9-12(17)10-16)20-21(5,6)15(2,3)4/h7,12-13H,1,8-11H2,2-6H3/t12-,13+/m0/s1 |
| InChIKey | NMBDMXFYIUMMRZ-QWHCGFSZSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate (CID 54118590) is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CI.
What is the InChIKey of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate?
The InChIKey is NMBDMXFYIUMMRZ-QWHCGFSZSA-N. The full InChI is InChI=1S/C15H28INO3Si/c1-7-8-19-14(18)17-11-13(9-12(17)10-16)20-21(5,6)15(2,3)4/h7,12-13H,1,8-11H2,2-6H3/t12-,13+/m0/s1.
What are the key properties of prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate?
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate has a molecular weight of 425.38 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(iodomethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 54118590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).