C15H22IN3O7 — CID 54119060
3-ethoxypropyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]carbamate (PubChem CID 54119060) has the molecular formula C15H22IN3O7 and a molecular weight of 483.26 g/mol. Its IUPAC name is 3-ethoxypropyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | 3-ethoxypropyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 54119060 |
| Molecular Formula | C15H22IN3O7 |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 3-ethoxypropyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCOCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1I |
| InChI | InChI=1S/C15H22IN3O7/c1-3-24-5-4-6-25-15(23)18-12-9(16)7-19(14(22)17-12)13-11(21)10(20)8(2)26-13/h7-8,10-11,13,20-21H,3-6H2,1-2H3,(H,17,18,22,23)/t8-,10-,11-,13-/m1/s1 |
| InChIKey | NMJAOCXFAUJSJI-UORFTKCHSA-N |
| XLogP | 0.46 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|