C19H19N3O — CID 5411943
N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide (PubChem CID 5411943) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 5411943 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)Cc2c[nH]c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C19H19N3O/c1-13-7-8-15(14(2)9-13)12-21-22-19(23)10-16-11-20-18-6-4-3-5-17(16)18/h3-9,11-12,20H,10H2,1-2H3,(H,22,23)/b21-12- |
| InChIKey | FIMAZZPSKRPBJT-MTJSOVHGSA-N |
| XLogP | 3.48 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|