C18H18N4OS — CID 54119628
3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 54119628) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | 3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 54119628 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | Cc1nn2c(C=CC(=O)N3CCCC3)c(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C18H18N4OS/c1-13-20-22-15(9-10-16(23)21-11-5-6-12-21)17(19-18(22)24-13)14-7-3-2-4-8-14/h2-4,7-10H,5-6,11-12H2,1H3 |
| InChIKey | NMSUURNTZOKQDQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|