C15H7F4N3O2S — CID 54119890
6,6,7,7-tetrafluoro-3-(thiophen-2-ylmethyl)-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile (PubChem CID 54119890) has the molecular formula C15H7F4N3O2S and a molecular weight of 369.30 g/mol. Its IUPAC name is 6,6,7,7-tetrafluoro-3-(thiophen-2-ylmethyl)-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile.
| Compound Name | 6,6,7,7-tetrafluoro-3-(thiophen-2-ylmethyl)-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile |
|---|---|
| PubChem CID | 54119890 |
| Molecular Formula | C15H7F4N3O2S |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 6,6,7,7-tetrafluoro-3-(thiophen-2-ylmethyl)-[1,4]dioxino[2,3-f]benzimidazole-2-carbonitrile |
| SMILES | N#Cc1nc2cc3c(cc2n1Cc1cccs1)OC(F)(F)C(F)(F)O3 |
| InChI | InChI=1S/C15H7F4N3O2S/c16-14(17)15(18,19)24-12-5-10-9(4-11(12)23-14)21-13(6-20)22(10)7-8-2-1-3-25-8/h1-5H,7H2 |
| InChIKey | NMXJFTFVDXYXQK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|