C46H80N2O5 — CID 54120015
3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethyl-1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexoxy]-3-oxopropanoic acid (PubChem CID 54120015) has the molecular formula C46H80N2O5 and a molecular weight of 741.15 g/mol. Its IUPAC name is 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethyl-1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexoxy]-3-oxopropanoic acid.
| Compound Name | 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethyl-1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 54120015 |
| Molecular Formula | C46H80N2O5 |
| Molecular Weight | 741.15 g/mol |
| Exact Mass | 740.61 |
| IUPAC Name | 3-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2-ethyl-1,1-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexoxy]-3-oxopropanoic acid |
| SMILES | CCCCC(CC)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(OC(=O)CC(=O)O)(C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C46H80N2O5/c1-19-21-22-45(20-2,26-31-23-34(39(3,4)5)38(52)35(24-31)40(6,7)8)46(53-37(51)25-36(49)50,32-27-41(9,10)47(17)42(11,12)28-32)33-29-43(13,14)48(18)44(15,16)30-33/h23-24,32-33,52H,19-22,25-30H2,1-18H3,(H,49,50) |
| InChIKey | NNAAEBJJYDOYLS-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.15 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|