About ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate
ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate (PubChem CID 54120246) has the molecular formula C11H17FO4
and a molecular weight of 232.25 g/mol. Its IUPAC name is ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate.
Molecular Properties
| Compound Name | ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate |
| PubChem CID | 54120246 |
| Molecular Formula | C11H17FO4 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate |
| SMILES | CCOC(=O)C(F)=CC(C)=CC(OC)OC |
| InChI | InChI=1S/C11H17FO4/c1-5-16-11(13)9(12)6-8(2)7-10(14-3)15-4/h6-7,10H,5H2,1-4H3 |
| InChIKey | NNEMJNRMMDFFSK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate?
The IUPAC name of ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate (CID 54120246) is ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate.
What is the SMILES notation for ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate?
The canonical SMILES for ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate is CCOC(=O)C(F)=CC(C)=CC(OC)OC.
What is the InChIKey of ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate?
The InChIKey is NNEMJNRMMDFFSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FO4/c1-5-16-11(13)9(12)6-8(2)7-10(14-3)15-4/h6-7,10H,5H2,1-4H3.
What are the key properties of ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate?
ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate has a molecular weight of 232.25 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-6,6-dimethoxy-4-methylhexa-2,4-dienoate is sourced from PubChem (CID 54120246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).