C11H16N2O3S — CID 54120469
(3aS,4S,6aR)-2-oxo-4-(5-oxopentyl)-3,3a,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-4-carbaldehyde (PubChem CID 54120469) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-oxo-4-(5-oxopentyl)-3,3a,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-4-carbaldehyde.
| Compound Name | (3aS,4S,6aR)-2-oxo-4-(5-oxopentyl)-3,3a,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 54120469 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (3aS,4S,6aR)-2-oxo-4-(5-oxopentyl)-3,3a,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-4-carbaldehyde |
| SMILES | O=CCCCC[C@]1(C=O)SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C11H16N2O3S/c14-5-3-1-2-4-11(7-15)9-8(6-17-11)12-10(16)13-9/h5,7-9H,1-4,6H2,(H2,12,13,16)/t8-,9-,11+/m0/s1 |
| InChIKey | LKWAGXIDDWHGJM-ATZCPNFKSA-N |
| XLogP | 0.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|