About 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine
5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine (PubChem CID 54120636) has the molecular formula C11H19N5
and a molecular weight of 221.31 g/mol. Its IUPAC name is 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine |
| PubChem CID | 54120636 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(NC2CCNCC2)nc(N)c1C |
| InChI | InChI=1S/C11H19N5/c1-7-8(2)14-11(16-10(7)12)15-9-3-5-13-6-4-9/h9,13H,3-6H2,1-2H3,(H3,12,14,15,16) |
| InChIKey | NNLKKPSGKTWZEY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine?
The IUPAC name of 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine (CID 54120636) is 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine.
What is the SMILES notation for 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine?
The canonical SMILES for 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine is Cc1nc(NC2CCNCC2)nc(N)c1C.
What is the InChIKey of 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine?
The InChIKey is NNLKKPSGKTWZEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5/c1-7-8(2)14-11(16-10(7)12)15-9-3-5-13-6-4-9/h9,13H,3-6H2,1-2H3,(H3,12,14,15,16).
What are the key properties of 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine?
5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine has a molecular weight of 221.31 g/mol, XLogP of 0.84, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-N-piperidin-4-ylpyrimidine-2,4-diamine is sourced from PubChem (CID 54120636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).