C21H28O4 — CID 541211
(5-methoxy-13-methyl-2-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) acetate (PubChem CID 541211) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (5-methoxy-13-methyl-2-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) acetate.
| Compound Name | (5-methoxy-13-methyl-2-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) acetate |
|---|---|
| PubChem CID | 541211 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (5-methoxy-13-methyl-2-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) acetate |
| SMILES | COC12C=CC(=O)C=C1C1CCC3(C)C(OC(C)=O)CCC3C1CC2 |
| InChI | InChI=1S/C21H28O4/c1-13(22)25-19-5-4-17-15-8-11-21(24-3)10-6-14(23)12-18(21)16(15)7-9-20(17,19)2/h6,10,12,15-17,19H,4-5,7-9,11H2,1-3H3 |
| InChIKey | NXEACZWFRKYPHS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |