About 5-chloro-3-phenyl-1,3-thiazolidin-4-one
5-chloro-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 54121276) has the molecular formula C9H8ClNOS
and a molecular weight of 213.69 g/mol. Its IUPAC name is 5-chloro-3-phenyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-chloro-3-phenyl-1,3-thiazolidin-4-one |
| PubChem CID | 54121276 |
| Molecular Formula | C9H8ClNOS |
| Molecular Weight | 213.69 g/mol |
| Exact Mass | 213.00 |
| IUPAC Name | 5-chloro-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1C(Cl)SCN1c1ccccc1 |
| InChI | InChI=1S/C9H8ClNOS/c10-8-9(12)11(6-13-8)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | NNVSWNQGRUIAAV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-phenyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-phenyl-1,3-thiazolidin-4-one?
The IUPAC name of 5-chloro-3-phenyl-1,3-thiazolidin-4-one (CID 54121276) is 5-chloro-3-phenyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-chloro-3-phenyl-1,3-thiazolidin-4-one?
The canonical SMILES for 5-chloro-3-phenyl-1,3-thiazolidin-4-one is O=C1C(Cl)SCN1c1ccccc1.
What is the InChIKey of 5-chloro-3-phenyl-1,3-thiazolidin-4-one?
The InChIKey is NNVSWNQGRUIAAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNOS/c10-8-9(12)11(6-13-8)7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of 5-chloro-3-phenyl-1,3-thiazolidin-4-one?
5-chloro-3-phenyl-1,3-thiazolidin-4-one has a molecular weight of 213.69 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-phenyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 54121276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).