About (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine
(8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine (PubChem CID 54121518) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine.
Molecular Properties
| Compound Name | (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine |
| PubChem CID | 54121518 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine |
| SMILES | CC1(CN)CC2C3CC4C2C4C31 |
| InChI | InChI=1S/C11H17N/c1-11(4-12)3-7-5-2-6-8(7)9(6)10(5)11/h5-10H,2-4,12H2,1H3 |
| InChIKey | NOAGBAUSSKBQAQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine?
The IUPAC name of (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine (CID 54121518) is (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine.
What is the SMILES notation for (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine?
The canonical SMILES for (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine is CC1(CN)CC2C3CC4C2C4C31.
What is the InChIKey of (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine?
The InChIKey is NOAGBAUSSKBQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-11(4-12)3-7-5-2-6-8(7)9(6)10(5)11/h5-10H,2-4,12H2,1H3.
What are the key properties of (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine?
(8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine has a molecular weight of 163.26 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-tetracyclo[4.3.0.02,4.03,7]nonanyl)methanamine is sourced from PubChem (CID 54121518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).