C19H32N2O14 — CID 54121556
[(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 54121556) has the molecular formula C19H32N2O14 and a molecular weight of 512.47 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | [(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 54121556 |
| Molecular Formula | C19H32N2O14 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [(2R,3R,4R,5R)-2-acetamido-4,5,6-trihydroxy-1-oxohexan-3-yl] (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@](O)(C(=O)O[C@@H]([C@H](O)[C@H](O)CO)[C@H](C=O)NC(C)=O)C[C@@H]1O |
| InChI | InChI=1S/C19H32N2O14/c1-7(25)20-9(4-22)16(14(30)11(28)5-23)34-18(32)19(33)3-10(27)13(21-8(2)26)17(35-19)15(31)12(29)6-24/h4,9-17,23-24,27-31,33H,3,5-6H2,1-2H3,(H,20,25)(H,21,26)/t9-,10-,11+,12+,13+,14+,15+,16+,17+,19-/m0/s1 |
| InChIKey | NOBFPFSPOOXBHK-HZHQCZJYSA-N |
| XLogP | -6.63 |
| TPSA | 272.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | -6.63 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|