About N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide
N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide (PubChem CID 5412158) has the molecular formula C13H13FN4O
and a molecular weight of 260.27 g/mol. Its IUPAC name is N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide |
| PubChem CID | 5412158 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide |
| SMILES | Cc1c(/C=N\NC(=O)c2ccc(F)cc2)cnn1C |
| InChI | InChI=1S/C13H13FN4O/c1-9-11(8-16-18(9)2)7-15-17-13(19)10-3-5-12(14)6-4-10/h3-8H,1-2H3,(H,17,19)/b15-7- |
| InChIKey | MDYBBNNUNVORBS-CHHVJCJISA-N |
| XLogP | 1.63 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide?
The IUPAC name of N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide (CID 5412158) is N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide.
What is the SMILES notation for N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide?
The canonical SMILES for N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide is Cc1c(/C=N\NC(=O)c2ccc(F)cc2)cnn1C.
What is the InChIKey of N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide?
The InChIKey is MDYBBNNUNVORBS-CHHVJCJISA-N. The full InChI is InChI=1S/C13H13FN4O/c1-9-11(8-16-18(9)2)7-15-17-13(19)10-3-5-12(14)6-4-10/h3-8H,1-2H3,(H,17,19)/b15-7-.
What are the key properties of N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide?
N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide has a molecular weight of 260.27 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-(1,5-dimethylpyrazol-4-yl)methylideneamino]-4-fluorobenzamide is sourced from PubChem (CID 5412158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).