C14H15N5O4 — CID 5412160
N-[(Z)-(4-methoxyphenyl)methylideneamino]-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 5412160) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[(Z)-(4-methoxyphenyl)methylideneamino]-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(4-methoxyphenyl)methylideneamino]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 5412160 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(Z)-(4-methoxyphenyl)methylideneamino]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)c2c([N+](=O)[O-])c(C)nn2C)cc1 |
| InChI | InChI=1S/C14H15N5O4/c1-9-12(19(21)22)13(18(2)17-9)14(20)16-15-8-10-4-6-11(23-3)7-5-10/h4-8H,1-3H3,(H,16,20)/b15-8- |
| InChIKey | KVECBUOTXLXSRZ-NVNXTCNLSA-N |
| XLogP | 1.41 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|