About 2-nitrosopropanoic acid
2-nitrosopropanoic acid (PubChem CID 54121669) has the molecular formula C3H5NO3
and a molecular weight of 103.08 g/mol. Its IUPAC name is 2-nitrosopropanoic acid.
Molecular Properties
| Compound Name | 2-nitrosopropanoic acid |
| PubChem CID | 54121669 |
| Molecular Formula | C3H5NO3 |
| Molecular Weight | 103.08 g/mol |
| Exact Mass | 103.03 |
| IUPAC Name | 2-nitrosopropanoic acid |
| SMILES | CC(N=O)C(=O)O |
| InChI | InChI=1S/C3H5NO3/c1-2(4-7)3(5)6/h2H,1H3,(H,5,6) |
| InChIKey | NODMSFUNHCUVST-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.08 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-nitrosopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosopropanoic acid?
The IUPAC name of 2-nitrosopropanoic acid (CID 54121669) is 2-nitrosopropanoic acid.
What is the SMILES notation for 2-nitrosopropanoic acid?
The canonical SMILES for 2-nitrosopropanoic acid is CC(N=O)C(=O)O.
What is the InChIKey of 2-nitrosopropanoic acid?
The InChIKey is NODMSFUNHCUVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO3/c1-2(4-7)3(5)6/h2H,1H3,(H,5,6).
What are the key properties of 2-nitrosopropanoic acid?
2-nitrosopropanoic acid has a molecular weight of 103.08 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosopropanoic acid is sourced from PubChem (CID 54121669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).