C18H24O7S — CID 54121690
[(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 54121690) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54121690 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H]3OC4(CCCCC4)O[C@@H]3[C@H]2O)cc1 |
| InChI | InChI=1S/C18H24O7S/c1-12-5-7-13(8-6-12)26(20,21)22-11-14-15(19)16-17(23-14)25-18(24-16)9-3-2-4-10-18/h5-8,14-17,19H,2-4,9-11H2,1H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | NODWYASCCWUVLD-YYIAUSFCSA-N |
| XLogP | 1.86 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|