About 5-iodo-1,3-dimethyl-2H-pyrazine
5-iodo-1,3-dimethyl-2H-pyrazine (PubChem CID 54121932) has the molecular formula C6H9IN2
and a molecular weight of 236.06 g/mol. Its IUPAC name is 5-iodo-1,3-dimethyl-2H-pyrazine.
Molecular Properties
| Compound Name | 5-iodo-1,3-dimethyl-2H-pyrazine |
| PubChem CID | 54121932 |
| Molecular Formula | C6H9IN2 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 5-iodo-1,3-dimethyl-2H-pyrazine |
| SMILES | CC1=NC(I)=CN(C)C1 |
| InChI | InChI=1S/C6H9IN2/c1-5-3-9(2)4-6(7)8-5/h4H,3H2,1-2H3 |
| InChIKey | NOHWTRSVTMIYAX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,3-dimethyl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,3-dimethyl-2H-pyrazine?
The IUPAC name of 5-iodo-1,3-dimethyl-2H-pyrazine (CID 54121932) is 5-iodo-1,3-dimethyl-2H-pyrazine.
What is the SMILES notation for 5-iodo-1,3-dimethyl-2H-pyrazine?
The canonical SMILES for 5-iodo-1,3-dimethyl-2H-pyrazine is CC1=NC(I)=CN(C)C1.
What is the InChIKey of 5-iodo-1,3-dimethyl-2H-pyrazine?
The InChIKey is NOHWTRSVTMIYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IN2/c1-5-3-9(2)4-6(7)8-5/h4H,3H2,1-2H3.
What are the key properties of 5-iodo-1,3-dimethyl-2H-pyrazine?
5-iodo-1,3-dimethyl-2H-pyrazine has a molecular weight of 236.06 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,3-dimethyl-2H-pyrazine is sourced from PubChem (CID 54121932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).