C15H17Cl2FO2 — CID 54121965
4-fluorohept-4-en-1-yn-3-yl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54121965) has the molecular formula C15H17Cl2FO2 and a molecular weight of 319.20 g/mol. Its IUPAC name is 4-fluorohept-4-en-1-yn-3-yl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 4-fluorohept-4-en-1-yn-3-yl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54121965 |
| Molecular Formula | C15H17Cl2FO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4-fluorohept-4-en-1-yn-3-yl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C#CC(OC(=O)C1C(C=C(Cl)Cl)C1(C)C)C(F)=CCC |
| InChI | InChI=1S/C15H17Cl2FO2/c1-5-7-10(18)11(6-2)20-14(19)13-9(8-12(16)17)15(13,3)4/h2,7-9,11,13H,5H2,1,3-4H3 |
| InChIKey | NOIMHERNBWWYFY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|